CAS 22864-92-2

1-[(13S)-1,2-dimethoxy-12-methyl-12,13-dihydro[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl]propan-2-one

Description:

1-[(13S)-1,2-dimethoxy-12-methyl-12,13-dihydro[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl]propan-2-one, with the CAS number 22864-92-2, is a complex organic compound characterized by its unique structural features, including a phenanthridine core fused with a benzodioxole moiety. This compound exhibits a chiral center, indicated by the (13S) designation, which contributes to its stereochemistry and potential biological activity. The presence of methoxy groups enhances its solubility and reactivity, while the ketone functional group (propan-2-one) suggests potential for further chemical transformations. Such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The intricate structure implies that it may interact with biological targets, potentially influencing various biochemical pathways. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical investigation or literature reference for comprehensive understanding. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₂₄H₂₃NO₅

InChI: InChI=1/C24H23NO5/c1-13(26)9-18-22-15(7-8-19(27-3)24(22)28-4)16-6-5-14-10-20-21(30-12-29-20)11-17(14)23(16)25(18)2/h5-8,10-11,18H,9,12H2,1-4H3/t18-/m0/s1

SMILES: CC(=O)C[C@H]1c2c(ccc(c2OC)OC)c2ccc3cc4c(cc3c2N1C)OCO4

Synonyms:

• 2-Propanone, 1-((13S)-12,13-dihydro-1,2-dimethoxy-12-methyl(1,3)benzodioxolo(5,6-c)phenanthridin-13-yl)-
• 6-Acetonyldihydrochelerythrine

2-Propanone,1-[(13S)-12,13-dihydro-1,2-dimethoxy-12-methyl[1,3]dioxolo[4,5]benzo[1,2-c]phenanthridin-13-yl]-

CAS: 22864-92-2

Formula: C₂₄H₂₃NO₅

Molecular weight: 405.4431

Ref: IN-DA007PEJ

6-Acetonyldihydrochelerythrine

CAS: 22864-92-2

6-Acetonyldihydrochelerythrine: anti-HIV, antioxidant, induces apoptosis, cytotoxic to HCT116/SW620 cells, more effective than 5-FU. EC50=1.77µg/mL, TI=14.6.

Formula: C₂₄H₂₃NO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 405.44

Ref: TM-TN3152

6-Acetonyldihydrochelerythrine

CAS: 22864-92-2

Formula: C₂₄H₂₃NO₅

Purity: 95%~99%

Color and Shape: Yellow powder

Molecular weight: 405.45

Ref: BP-SBP01489

6-Acetonyldihydrochelerythrine

CAS: 22864-92-2

6-Acetonyldihydrochelerythrine is a synthetic derivative of the natural alkaloid dihydrochelerythrine, which is typically sourced from plants in the Papaveraceae family, such as Chelidonium majus. This compound belongs to the benzophenanthridine alkaloids, known for their bioactive properties. The modification at the acetone site is intended to alter its solubility, stability, or interactions with biological targets.

Formula: C₂₄H₂₃NO₅

Purity: Min. 95%

Molecular weight: 405.4 g/mol

Ref: 3D-XAA86492