CAS 22865-52-7

4-[(4-methylphenyl)sulfanyl]aniline

Description:

4-[(4-Methylphenyl)sulfanyl]aniline, also known by its CAS number 22865-52-7, is an organic compound characterized by the presence of an aniline group substituted with a sulfanyl (thioether) moiety and a para-methylphenyl group. This compound features a sulfur atom bonded to a phenyl ring, which enhances its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of the methyl group on the phenyl ring contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. The compound may exhibit properties such as moderate to high melting and boiling points, depending on its molecular interactions. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-donating nature of the aniline group. Safety data should be consulted for handling, as compounds with similar structures can exhibit toxicity or environmental hazards. Overall, 4-[(4-methylphenyl)sulfanyl]aniline is a versatile compound with potential applications in synthetic organic chemistry.

Formula: C₁₃H₁₃NS

InChI: InChI=1/C13H13NS/c1-10-2-6-12(7-3-10)15-13-8-4-11(14)5-9-13/h2-9H,14H2,1H3

SMILES: Cc1ccc(cc1)Sc1ccc(cc1)N

Synonyms:

• Benzenamine, 4-[(4-Methylphenyl)Thio]-
• 4-[(4-METHYLPHENYL)SULFANYL]ANILINE

4-(p-Tolylthio)aniline

CAS: 22865-52-7

Formula: C₁₃H₁₃NS

Molecular weight: 215.3140

Ref: IN-DA00BH0S

4-[(4-Methylphenyl)thio]aniline

CAS: 22865-52-7

4-[(4-Methylphenyl)thio]aniline

Purity: 95%

Molecular weight: 215.32g/mol

Ref: 54-OR1004278

4-[(4-Methylphenyl)thio]aniline

CAS: 22865-52-7

Formula: C₁₃H₁₃NS

Purity: 97.0%

Molecular weight: 215.31

Ref: 10-F064698

4-[(4-methylphenyl)sulfanyl]aniline

CAS: 22865-52-7

4-[(4-Methylphenyl)sulfanyl]aniline is a heterocyclic organic compound that reacts with molecular oxygen to form an ionic liquid. The reaction system is catalytic and the byproduct of this reaction is a heterocycle. 4-[(4-Methylphenyl)sulfanyl]aniline has been shown to react with terminal oxidant and function as an oxidant to produce unsymmetrical amines. Advances in this area include the use of ionic liquids, which are liquids that are composed of ions, such as but not limited to salts, esters, or amides.

Purity: Min. 95%

Ref: 3D-FM170009