CAS 22867-74-9
:7-Ethylindole
Description:
7-Ethylindole is an organic compound that belongs to the class of indoles, which are bicyclic structures containing a fused benzene and pyrrole ring. This compound is characterized by the presence of an ethyl group attached to the nitrogen atom of the indole structure at the 7-position. It is typically a colorless to pale yellow liquid with a distinctive aromatic odor. 7-Ethylindole is known for its role in various chemical reactions and can serve as a building block in organic synthesis. It exhibits moderate solubility in organic solvents and is relatively stable under standard conditions. The compound has garnered interest in fields such as medicinal chemistry and materials science due to its potential biological activities and applications. As with many indole derivatives, it may exhibit properties such as fluorescence and can participate in various chemical transformations, making it a valuable compound in research and industrial applications. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C10H11N
InChI:InChI=1/C10H11N/c1-2-8-4-3-5-9-6-7-11-10(8)9/h3-7,11H,2H2,1H3
SMILES:CCc1cccc2cc[nH]c12
Synonyms:- 1H-indole, 7-ethyl-
- 7-Ethyl-1H-indole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
7-Ethylindole, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H11NPurity:98+%Color and Shape:Clear colorless to pale yellow to yellow to red to brown or pink, Liquid or viscous liquidMolecular weight:145.217-Ethyl-1H-indole
CAS:Formula:C10H11NPurity:>98.0%(GC)Color and Shape:Colorless to Yellow clear liquidMolecular weight:145.217-Ethylindole
CAS:7-Ethylindole is a fatty acid with a cationic surfactant that belongs to the group of mesoporous materials. It has been synthesized by using chromatographic method and sample preparation techniques. The synthetic process is based on the protonation of 7-ethylindole. It undergoes dehydrogenation and activation energy, which is programmed in copper chromite. The chemical compositions are chloride, hydrogenated, and activated 7-ethylindole.Formula:C10H11NPurity:Min. 95%Molecular weight:145.2 g/mol7-Ethylindole
CAS:7-Ethylindole is a versatile chemical building block that can be used for the synthesis of complex compounds. It has been used as a reagent and speciality chemical in research and is also useful as an intermediate to synthesize other organic molecules. 7-Ethylindole is soluble in organic solvents, such as dichloromethane or acetone, but insoluble in water. The CAS number for this compound is 22867-74-9.Formula:C10H11NMolecular weight:145.21 g/molRef: 3D-E-7880
1kgTo inquire100gTo inquire250gTo inquire500gTo inquire2500gTo inquire-Unit-ggTo inquire








