CAS 22868-35-5

2-(3-chlorophenyl)-1H-benzimidazole

Description:

2-(3-Chlorophenyl)-1H-benzimidazole is an organic compound characterized by its benzimidazole core, which consists of a fused benzene and imidazole ring. The presence of a 3-chlorophenyl group at the 2-position of the benzimidazole structure contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic components. It is often studied for its potential biological activities, including antimicrobial and anticancer properties, owing to the structural features that allow for interactions with biological targets. The chlorine substituent can influence the compound's reactivity and biological activity, making it a subject of interest in medicinal chemistry. Additionally, the compound may undergo various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, depending on the reaction conditions. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.

Formula: C₁₃H₉ClN₂

InChI: InChI=1/C13H9ClN2/c14-10-5-3-4-9(8-10)13-15-11-6-1-2-7-12(11)16-13/h1-8H,(H,15,16)

SMILES: c1ccc2c(c1)nc(c1cccc(c1)Cl)[nH]2

Synonyms:

• 1H-Benzimidazole, 2-(3-chlorophenyl)-
• G-573

2-(3-Chlorophenyl)-1H-benzo[d]imidazole

CAS: 22868-35-5

2-(3-Chlorophenyl)-1H-benzo[d]imidazole

Purity: 97%

Molecular weight: 228.68g/mol

Ref: 54-OR1057848

G-573

CAS: 22868-35-5

G-573, a potent MEK inhibitor, has an IC50 of 0.406µM for pERK and inhibits HCT116/H2122 tumor growth with IC50s of 3.43/2.56µM.

Formula: C₁₃H₉ClN₂

Color and Shape: Solid

Molecular weight: 228.68

Ref: TM-T71891