CAS 2287-83-4: bis(2-ethylhexyl) itaconate
Description:Bis(2-ethylhexyl) itaconate, with the CAS number 2287-83-4, is an ester derived from itaconic acid and 2-ethylhexanol. This compound is characterized by its clear, colorless liquid form and is known for its low volatility and relatively high boiling point. It exhibits good solubility in organic solvents, making it useful in various applications, particularly in the production of polymers and as a plasticizer. The presence of the itaconate moiety imparts unique properties, such as the ability to undergo polymerization, which can enhance the mechanical and thermal properties of the resulting materials. Additionally, bis(2-ethylhexyl) itaconate is recognized for its compatibility with other plasticizers and its potential to improve the flexibility and durability of polymer formulations. Safety data indicates that it should be handled with care, as with many chemical substances, due to potential irritant properties. Overall, bis(2-ethylhexyl) itaconate is valued in industrial applications for its performance-enhancing characteristics in polymer chemistry.
Formula:C21H38O4
InChI:InChI=1/C21H38O4/c1-6-10-12-18(8-3)15-24-20(22)14-17(5)21(23)25-16-19(9-4)13-11-7-2/h18-19H,5-16H2,1-4H3
- Synonyms:
- Itaconic acid di(2-ethylhexyl)ester
- Bis(2-Ethylhexyl) 2-Methylidenebutanedioate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | ITACONIC ACID DI(2-ETHYLHEXYL) ESTER REF: IN-DA003R5YCAS: 2287-83-4 | 94% | 51.00 €~102.00 € | Tue 15 Apr 25 |
![]() | Bis(2-ethylhexyl) 2-methylenesuccinate REF: 10-F772281CAS: 2287-83-4 | 98% | - - - | Discontinued product |
![]() | Bis(2-ethylhexyl) Itaconate (stabilized with HQ) REF: 3B-I0205CAS: 2287-83-4 | >94.0%(GC) | - - - | Discontinued product |
![]() | Bis(2-ethylhexyl) Itaconate REF: 3D-CAA28783CAS: 2287-83-4 | Min. 95% | - - - | Discontinued product |

ITACONIC ACID DI(2-ETHYLHEXYL) ESTER
Ref: IN-DA003R5Y
1g | 51.00 € | ||
5g | 102.00 € |

Ref: 10-F772281
25g | Discontinued | Request information |

Bis(2-ethylhexyl) Itaconate (stabilized with HQ)
Ref: 3B-I0205
25ml | Discontinued | Request information |

Bis(2-ethylhexyl) Itaconate
Ref: 3D-CAA28783
10ml | Discontinued | Request information | |
25ml | Discontinued | Request information | |
50ml | Discontinued | Request information | |
100ml | Discontinued | Request information | |
250ml | Discontinued | Request information |