CAS 22871-77-8

1-Naphthaleneboronic acid neopentyl glycol cyclic ester

Description:

1-Naphthaleneboronic acid neopentyl glycol cyclic ester, with the CAS number 22871-77-8, is a boronic acid derivative characterized by its unique structure that combines a naphthalene moiety with a boronic acid functional group and a neopentyl glycol cyclic ester. This compound typically exhibits properties associated with both boronic acids and cyclic esters, such as moderate solubility in organic solvents and potential reactivity with diols and other nucleophiles. The presence of the boronic acid group allows for participation in various chemical reactions, including Suzuki coupling, making it valuable in organic synthesis and materials science. Additionally, the cyclic ester component may impart stability and influence the compound's physical properties, such as melting point and boiling point. Overall, this compound is of interest in medicinal chemistry and materials development due to its functional versatility and potential applications in drug design and polymer chemistry.

Formula: C₁₅H₁₇BO₂

InChI: InChI=1/C15H17BO2/c1-15(2)10-17-16(18-11-15)14-9-5-7-12-6-3-4-8-13(12)14/h3-9H,10-11H2,1-2H3

SMILES: CC1(C)COB(c2cccc3ccccc23)OC1

Synonyms:

• 5,5-Dimethyl-2-Naphthalen-1-Yl-1,3,2-Dioxaborinane

1-Naphthaleneboronic acid neopentyl glycol ester

CAS: 22871-77-8

Formula: C₁₅H₁₇BO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 240.1053

Ref: IN-DA003EJA

5,5-Dimethyl-2-(naphthalen-1-yl)-1,3,2-dioxaborinane

CAS: 22871-77-8

5,5-Dimethyl-2-(naphthalen-1-yl)-1,3,2-dioxaborinane

Purity: 99%

Molecular weight: 240.11g/mol

Ref: 54-OR310989

5,5-Dimethyl-2-(naphthalen-1-yl)-1,3,2-dioxaborinane

CAS: 22871-77-8

Purity: 97%

Molecular weight: 240.1100006

Ref: 10-F692731