CAS 228728-19-6
:6,8-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
Description:
6,8-Difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid is a synthetic organic compound characterized by its quinoline structure, which features a fused bicyclic system. The presence of two fluorine atoms at the 6 and 8 positions contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential as an antibacterial or antiviral agent, owing to the structural motifs common in pharmacologically active compounds. Its molecular structure allows for various chemical modifications, which can be explored to optimize its efficacy and selectivity. Additionally, the compound's stability, reactivity, and interaction with other molecules can be influenced by the presence of the fluorine atoms and the carboxylic acid group, making it a subject of study in drug development and material science.
Formula:C10H5F2NO3
InChI:InChI=1/C10H5F2NO3/c11-4-1-5-8(7(12)2-4)13-3-6(9(5)14)10(15)16/h1-3H,(H,13,14)(H,15,16)
InChI key:InChIKey=SUJKVJSPRDGSJX-UHFFFAOYSA-N
SMILES:OC=1C2=C(N=CC1C(O)=O)C(F)=CC(F)=C2
Synonyms:- 3-Quinolinecarboxylic Acid, 6,8-Difluoro-4-Hydroxy-
- 6,8-Difluoro-4-hydroxy-3-quinolinecarboxylic acid
- 6,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid
CAS:6,8-Difluoro-4-hydroxyquinoline-3-carboxylic acidPurity:≥95%Molecular weight:225.15g/mol6,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid
CAS:<p>6,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid is a pyrrolidinyl quinolinecarboxylic acid that is structurally similar to ciprofloxacin. It inhibits the bacterial enzyme GyrA and GyrB, which are involved in DNA replication. 6,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid has been shown to be effective against gram negative bacteria and can be used as an antibacterial agent. This drug also inhibits the synthesis of RNA by binding to the ribosome at the peptidyl transferase site and blocks protein synthesis, which leads to cell death by inhibiting the production of proteins necessary for cell division. 6,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid is being investigated as a potential chemotherapeutic agent for cancer treatment due to its</p>Formula:C10H5F2NO3Purity:Min. 95%Molecular weight:225.15 g/mol
