CAS 22876-28-4
:2,4-dichlorophenyl ethyl carbonate
Description:
2,4-Dichlorophenyl ethyl carbonate, with the CAS number 22876-28-4, is an organic compound characterized by its structure, which includes a dichlorophenyl group and an ethyl carbonate moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate volatility. It is soluble in organic solvents but has limited solubility in water, which is common for many organic carbonates. The presence of chlorine atoms in the phenyl ring contributes to its chemical reactivity and potential applications in various fields, including agrochemicals and pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety considerations are important, as it may pose risks if inhaled or ingested, and appropriate handling procedures should be followed. Overall, 2,4-dichlorophenyl ethyl carbonate is a compound of interest due to its unique structural features and potential applications in chemical synthesis and industry.
Formula:C9H8Cl2O3
InChI:InChI=1/C9H8Cl2O3/c1-2-13-9(12)14-8-4-3-6(10)5-7(8)11/h3-5H,2H2,1H3
SMILES:CCOC(=O)Oc1ccc(cc1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
