CAS 228809-78-7
:3,5-Dichloro-4-Amino Pyridine
Description:
3,5-Dichloro-4-amino pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features two chlorine substituents at the 3 and 5 positions and an amino group at the 4 position of the pyridine ring. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. Typically, compounds like 3,5-dichloro-4-amino pyridine exhibit moderate to high solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. The chlorinated nature of the compound may also impart unique properties, such as increased lipophilicity and altered electronic characteristics. Safety data sheets would indicate that it should be handled with care, as halogenated compounds can pose environmental and health risks. Overall, this compound's structure and substituents suggest it may serve as a valuable intermediate in synthetic chemistry or as a building block for more complex molecules.
Formula:C5H4Cl2N2
InChI:InChI=1/C5H4Cl2N2/c6-3-1-9-2-4(7)5(3)8/h1-2H,(H2,8,9)
SMILES:c1c(c(=N)c(c[nH]1)Cl)Cl
Synonyms:- 4-Amino-3,5-Dichloro Pyridine
- 3,5-Dichloropyridin-4-Amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Roflumilast Impurity 16
CAS:Formula:C5H4Cl2N2Color and Shape:White To Off-White SolidMolecular weight:163.00
