CAS 22886-46-0
:1-({[2-amino-5-(carbamoyloxy)-3,4-dihydroxypentanoyl]amino}[5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl]acetyl)-3-ethenylazetidine-2-carboxylic acid (non-preferred name)
Description:
The chemical substance with the name "1-({[2-amino-5-(carbamoyloxy)-3,4-dihydroxypentanoyl]amino}[5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl]acetyl)-3-ethenylazetidine-2-carboxylic acid" and CAS number 22886-46-0 is a complex organic compound characterized by its intricate structure, which includes multiple functional groups such as amino, hydroxyl, and carboxylic acid groups. This compound is likely to exhibit properties typical of amino acids and peptides, including potential solubility in water due to the presence of polar functional groups. Its structure suggests it may participate in various biochemical interactions, possibly acting as a substrate or inhibitor in enzymatic reactions. The presence of a dioxo-pyrimidine moiety indicates potential biological activity, possibly related to nucleic acid metabolism or cellular signaling pathways. Additionally, the azetidine ring may contribute to its stability and reactivity. Overall, this compound's complexity suggests it could have applications in medicinal chemistry or biochemistry, although specific biological activities would require further investigation.
Formula:C22H30N6O13
InChI:InChI=1/C22H30N6O13/c1-2-7-5-28(12(7)20(36)37)18(35)11(26-17(34)10(23)13(31)8(29)6-40-21(24)38)16-14(32)15(33)19(41-16)27-4-3-9(30)25-22(27)39/h2-4,7-8,10-16,19,29,31-33H,1,5-6,23H2,(H2,24,38)(H,26,34)(H,36,37)(H,25,30,39)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Polyoxin K
CAS:<p>Polyoxin K is a nucleoside antifungal antibiotic that exhibits significant effectiveness against rice sheath blight.</p>Formula:C22H30N6O13Molecular weight:586.51

