CAS 228862-97-3

(2R,3R,5R)-2-(aminomethyl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol

Description:

The chemical substance known as (2R,3R,5R)-2-(aminomethyl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol, with the CAS number 228862-97-3, is a chiral compound featuring a tetrahydrofuran ring. This structure includes multiple functional groups, such as an amino group and hydroxymethyl groups, which contribute to its reactivity and potential biological activity. The presence of these functional groups suggests that the compound may participate in hydrogen bonding and other intermolecular interactions, making it of interest in medicinal chemistry and pharmaceutical applications. Its stereochemistry, indicated by the (2R,3R,5R) configuration, is crucial for its biological activity, as the spatial arrangement of atoms can significantly influence how the molecule interacts with biological targets. Additionally, the compound may exhibit solubility in polar solvents due to its hydroxyl groups, which can enhance its utility in various chemical reactions and formulations. Overall, this compound's unique structural features make it a candidate for further research in drug development and other chemical applications.

Formula: C₆H₁₃NO₄

InChI: InChI=1/C6H13NO4/c7-1-3-5(9)6(10)4(2-8)11-3/h3-6,8-10H,1-2,7H2/t3-,4-,5+,6?/m1/s1

1-Amino-2,5-anhydro-1-deoxy-D-mannitol

CAS: 228862-97-3

Formula: C₆H₁₃NO₄

Color and Shape: Liquid

Molecular weight: 163.1717

Ref: IN-DA002LCW

1-Amino-2,5-anhydro-1-deoxy-D-mannitol

CAS: 228862-97-3

Molecular weight: 163.17

Ref: 7W-GC4281

1-Amino-2,5-anhydro-1-deoxy-D-mannitol

Controlled Product

CAS: 228862-97-3

Formula: C₆H₁₃NO₄

Color and Shape: Neat

Molecular weight: 163.17

Ref: TR-A582100

1-Amino-2,5-anhydro-1-deoxy-D-mannitol

CAS: 228862-97-3

1-Amino-2,5-anhydro-1-deoxy-D-mannitol is an amino sugar that is synthesized by reductive amination of d-fructose and nitrous acid. It has been shown to be a substrate for the transporter protein, which transports it into the cell. 1-Amino-2,5-anhydro-1-deoxy-D-mannitol has been used in the synthesis of arylamines with nitrous acid as a reducing agent. This process has been used to study the stereospecificity of reductive amination.

Formula: C₆H₁₃NO₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 163.17 g/mol

Ref: 3D-MA04471