CAS 2289-03-4
:1-oxo-1H-isochromene-3-carboxylic acid
Description:
1-Oxo-1H-isochromene-3-carboxylic acid, with the CAS number 2289-03-4, is an organic compound characterized by its isochromene structure, which features a fused benzene and a lactone ring. This compound typically exhibits a carboxylic acid functional group, contributing to its acidic properties. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly due to its ability to serve as a building block for more complex molecules. The presence of the carbonyl group (oxo) enhances its reactivity, making it a useful intermediate in various chemical reactions. Additionally, the compound may display interesting biological activities, which can be explored for pharmaceutical purposes. Its solubility and stability can vary depending on the solvent and conditions, which is important for its practical applications. Overall, 1-oxo-1H-isochromene-3-carboxylic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C10H6O4
InChI:InChI=1/C10H6O4/c11-9(12)8-5-6-3-1-2-4-7(6)10(13)14-8/h1-5H,(H,11,12)
SMILES:c1ccc2c(c1)cc(C(=O)O)oc2=O
Synonyms:- 1H-2-benzopyran-3-carboxylic acid, 1-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.