CAS 229009-40-9

[4-(4-methylpiperazin-1-yl)phenyl]boronic acid

Description:

[4-(4-methylpiperazin-1-yl)phenyl]boronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a 4-methylpiperazine moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The piperazine ring contributes to its potential biological activity, as piperazine derivatives are often found in pharmaceuticals. The compound is likely to be a solid at room temperature, with solubility in polar solvents due to the presence of the boronic acid group. Its structure allows for potential interactions with biological targets, which can be explored in drug development. Additionally, the presence of the boron atom may facilitate its use in cross-coupling reactions in organic synthesis, highlighting its versatility in chemical applications. Overall, this compound represents a valuable building block in both synthetic and medicinal chemistry.

Formula: C₁₁H₁₇BN₂O₂

InChI: InChI=1/C11H17BN2O2/c1-13-6-8-14(9-7-13)11-4-2-10(3-5-11)12(15)16/h2-5,15-16H,6-9H2,1H3

SMILES: CN1CCN(CC1)c1ccc(cc1)B(O)O

Synonyms:

• Boronic acid, B-[4-(4-methyl-1-piperazinyl)phenyl]-
• (4-(4-Methylpiperazin-1-yl)phenyl)boronicacid
• 4-(4-Methylpiperazin-1-Yl)Phenylboronic Acid

Boronic acid, B-[4-(4-methyl-1-piperazinyl)phenyl]-

CAS: 229009-40-9

Formula: C₁₁H₁₇BN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 220.0759

Ref: IN-DA002LF6

4-(4-Methylpiperazin-1-yl)phenylboronic acid

CAS: 229009-40-9

4-(4-Methylpiperazin-1-yl)phenylboronic acid

Formula: C₁₁H₁₇BN₂O₂

Purity: 99%

Color and Shape: white solid

Molecular weight: 220.08g/mol

Ref: 54-OR360145

4-(4-Methylpiperazin-1-yl)phenylboronic acid

CAS: 229009-40-9

Formula: C₁₁H₁₇BN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 220.08

Ref: 10-F079794