CAS 22901-09-3
:2-(2-Bromoethyl)benzaldehyde
Description:
2-(2-Bromoethyl)benzaldehyde, with the CAS number 22901-09-3, is an organic compound characterized by the presence of both a benzaldehyde functional group and a bromoethyl substituent. This compound typically appears as a colorless to pale yellow liquid and has a distinctive aromatic odor due to the benzaldehyde moiety. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water. The presence of the bromine atom introduces reactivity, making it a useful intermediate in organic synthesis, particularly in the formation of various derivatives through nucleophilic substitution reactions. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry contexts. Safety precautions should be taken when handling this substance, as it may pose health risks, including irritation to the skin and respiratory system. Proper storage in a cool, dry place away from light is recommended to maintain its stability and integrity.
Formula:C9H9BrO
InChI:InChI=1/C9H9BrO/c10-6-5-8-3-1-2-4-9(8)7-11/h1-4,7H,5-6H2
SMILES:c1ccc(C=O)c(c1)CCBr
Synonyms:- o-(2-Bromoethyl)benzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzaldehyde, 2-(2-bromoethyl)-
CAS:Formula:C9H9BrOPurity:95%Color and Shape:LiquidMolecular weight:213.07122-(2-Bromoethyl)benzaldehyde
CAS:2-(2-Bromoethyl)benzaldehyde is an organic compound that is used in the synthesis of many other compounds. It is produced by the acetylation of 2-bromoethanol with acetic anhydride and hydrochloric acid. This reaction mechanism starts with the formation of a carbocation from the protonated bromine and ethylene, followed by nucleophilic attack by the acetate anion to form a tertiary alcohol. The final step involves elimination of bromine to give 2-(2-bromoethyl)benzaldehyde. Techniques such as basic hydrolysis or chiral resolution can be used to produce optically pure 2-(2-bromoethyl)benzaldehyde.Formula:C9H9BrOPurity:(%) Min. 80%Color and Shape:Clear LiquidMolecular weight:213.07 g/mol1-Formyl-2-(2-bromoethyl)benzene
CAS:Formula:C9H9BrOPurity:95%Color and Shape:LiquidMolecular weight:213.074



