CAS 22913-26-4
:3-Thiophenecarboxylic acid, methyl ester
Description:
3-Thiophenecarboxylic acid, methyl ester, is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group that is esterified with a methyl group, making it a methyl ester. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the thiophene ring imparts unique electronic properties, making it useful in various applications, including pharmaceuticals, agrochemicals, and materials science. The compound is generally soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic thiophene structure. Its reactivity is influenced by the functional groups present, allowing for potential derivatization and further chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H6O2S
InChI:InChI=1S/C6H6O2S/c1-8-6(7)5-2-3-9-4-5/h2-4H,1H3
InChI key:InChIKey=ZTRAEMILTFNZSM-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=CSC1
Synonyms:- 3-(Methoxycarbonyl)thiophene
- 3-Methoxycarbonylthiophene
- 3-Thiophenecarboxylic Acid, Methyl Ester
- Methyl thiophene-3-carboxylate
- T5Sj Cvo1 [Wln]
- Methyl 3-thiophenecarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl Thiophene-3-carboxylate
CAS:Formula:C6H6O2SPurity:>97.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:142.17Methyl thiophene-3-carboxylate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H6O2SPurity:97%Molecular weight:142.173-Thiophenecarboxylic acid, methyl ester
CAS:Formula:C6H6O2SPurity:98%Color and Shape:LiquidMolecular weight:142.1756Methyl 3-thiophenecarboxylate
CAS:Methyl 3-thiophenecarboxylatePurity:98%Molecular weight:142.18g/molMethyl 3-thiophenecarboxylate
CAS:Formula:C6H6O2SPurity:95%Color and Shape:LiquidMolecular weight:142.17




