CAS 229163-39-7

1-(4-bromophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid

Description:

1-(4-bromophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid, with the CAS number 229163-39-7, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a bromophenyl group at one position of the pyrazole ring, contributing to its potential reactivity and biological activity. The presence of a carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and may influence its acidity and reactivity. The methyl group at the 5-position can affect the steric and electronic properties of the molecule, potentially impacting its interactions in biological systems. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. As with many pyrazole derivatives, it may also serve as a scaffold for further chemical modifications to enhance its efficacy or selectivity in therapeutic applications.

Formula: C₁₁H₉BrN₂O₂

InChI: InChI=1/C11H9BrN2O2/c1-7-6-10(11(15)16)13-14(7)9-4-2-8(12)3-5-9/h2-6H,1H3,(H,15,16)

SMILES: Cc1cc(C(=O)O)nn1c1ccc(cc1)Br

Synonyms:

• 1-(4-Bromo-phenyl)-5-methyl-1H-pyrazole-3-carboxylic acid

1-(4-Bromophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid

CAS: 229163-39-7

Versatile small molecule scaffold

Formula: C₁₁H₉BrN₂O₂

Purity: Min. 95%

Molecular weight: 281.1 g/mol

Ref: 3D-EJA16339