CAS 229180-64-7
:Fmoc-L-4-Phosphonomethylphenylalanine
Description:
Fmoc-L-4-Phosphonomethylphenylalanine is a synthetic amino acid derivative characterized by the presence of a phosphonomethyl group attached to the phenylalanine side chain. This compound is notable for its use in peptide synthesis, particularly in the development of phosphonate-containing peptides, which can exhibit unique biological activities. The Fmoc (9-fluorenylmethoxycarbonyl) group serves as a protective group for the amino functionality, allowing for selective reactions during peptide assembly. The presence of the phosphonomethyl group enhances the compound's potential for interaction with biological targets, making it of interest in medicinal chemistry and drug design. Additionally, the compound is typically soluble in organic solvents, which facilitates its use in various synthetic protocols. Its structure contributes to its stability and reactivity, making it a valuable building block in the synthesis of more complex molecules. Overall, Fmoc-L-4-Phosphonomethylphenylalanine is a versatile compound with significant implications in biochemical research and pharmaceutical applications.
Formula:C25H24NO7P
InChI:InChI=1/C25H24NO7P/c27-24(28)23(13-16-9-11-17(12-10-16)15-34(30,31)32)26-25(29)33-14-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-12,22-23H,13-15H2,(H,26,29)(H,27,28)(H2,30,31,32)/t23-/m0/s1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=N[C@@H](Cc1ccc(cc1)CP(=O)(O)O)C(=O)O)O
Synonyms:- N-[(9H-fluoren-9-ylmethoxy)carbonyl]-4-(phosphonomethyl)-L-phenylalanine
- Fmoc-L-4-Pmp
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
L-Phenylalanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-4-(phosphonomethyl)-
CAS:Formula:C25H24NO7PPurity:98%Color and Shape:SolidMolecular weight:481.4343(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-(phosphonomethyl)phenyl)propanoic acid
CAS:(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-(phosphonomethyl)phenyl)propanoic acid
Purity:95%Molecular weight:481.43g/molFmoc-4-(phosphonomethyl)-Phe-OH
CAS:Formula:C25H24NO7PPurity:≥ 95.0%Color and Shape:White to off-white powderMolecular weight:481.43(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-(phosphonomethyl)phenyl)propanoic acid
CAS:Purity:98%Molecular weight:481.4410095Fmoc-4-phosphomethyl-L-phenylalanine
CAS:Fmoc-4-phosphomethyl-L-phenylalanine** is a specialized amino acid derivative used primarily in the field of peptide synthesis. It is a synthesized compound that serves as a building block for creating phosphorylated peptides. The compound is characterized by the presence of a phosphomethyl group attached to the phenylalanine side chain, along with a 9-fluorenylmethoxycarbonyl (Fmoc) group for temporary N-terminal protection during peptide assembly.This product plays a crucial role in the synthesis of peptides by allowing the incorporation of a phosphomethyl moiety, which is crucial for mimicking the phosphorylation of proteins—a key post-translational modification. Through its well-designed chemical structure, it facilitates the formation of peptide bonds while maintaining the integrity of sensitive side chain functionalities during synthesis.Fmoc-4-phosphomethyl-L-phenylalanine is widely used in biochemical and pharmaceutical research where the study of protein phosphorylation is paramount. It provides researchers with the means to construct peptides that closely resemble the natural phosphorylated proteins found within biological systems, thereby enabling more accurate studies of protein function and interaction. This makes it an invaluable tool in the exploration of cellular signaling pathways and protein regulation mechanisms.Formula:C25H24NO7PPurity:Min. 95%Molecular weight:481.43 g/mol




