CAS 22919-28-4
:3,5-Cyclohexadiene-1,2-dicarboxylic acid
Description:
3,5-Cyclohexadiene-1,2-dicarboxylic acid, with the CAS number 22919-28-4, is an organic compound characterized by its dicarboxylic acid functional groups attached to a cyclohexadiene ring. This compound features two carboxylic acid (-COOH) groups located at the 1 and 2 positions of the cyclohexadiene structure, which contributes to its acidity and reactivity. The presence of the double bonds in the cyclohexadiene framework imparts unsaturation, making it more reactive than saturated compounds. It is typically a colorless to pale yellow solid at room temperature and is soluble in polar solvents due to the carboxylic acid groups. The compound can participate in various chemical reactions, including esterification and polymerization, and may serve as an intermediate in organic synthesis. Its unique structure allows for potential applications in the development of pharmaceuticals, agrochemicals, and materials science. However, handling should be done with care, as with many organic acids, due to potential irritant properties.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-6H,(H,9,10)(H,11,12)
InChI key:InChIKey=OYUWHGGWLCJJNP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(C(O)=O)C=CC=C1
Synonyms:- 1,3-Cyclohexadiene-5,6-dicarboxylic acid
- 3,5-Cyclohexadiene-1,2-dicarboxylic acid
- Cyclohexa-3,5-Diene-1,2-Dicarboxylic Acid
- Dihydrophthalic acid
- Nsc 131336
- 1,2-Dihydrophthalic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
