CAS 22921-76-2
:1-(2-Bromoethoxy)-4-methoxybenzene
Description:
1-(2-Bromoethoxy)-4-methoxybenzene, with the CAS number 22921-76-2, is an organic compound characterized by its aromatic structure and the presence of both bromine and methoxy functional groups. This compound features a benzene ring substituted with a methoxy group (-OCH3) at the para position and a bromoethoxy group (-OCH2CHBr2) at the ortho position. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy group contributes to the compound's electron-donating properties, which can influence its reactivity and solubility in organic solvents. Typically, compounds like this may exhibit moderate to high lipophilicity, affecting their behavior in biological systems and their potential applications in pharmaceuticals or agrochemicals. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the specific conditions under which it is studied.
Formula:C9H11BrO2
InChI:InChI=1/C9H11BrO2/c1-11-8-2-4-9(5-3-8)12-7-6-10/h2-5H,6-7H2,1H3
SMILES:COc1ccc(cc1)OCCBr
Synonyms:- Akos Bc-2661
- Chembrdg-Bb 5470024
- Asischem Z95336
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzene, 1-(2-bromoethoxy)-4-methoxy-
CAS:Formula:C9H11BrO2Purity:97%Color and Shape:SolidMolecular weight:231.08641-(2-Bromoethoxy)-4-methoxybenzene
CAS:1-(2-Bromoethoxy)-4-methoxybenzenePurity:95%Molecular weight:231.09g/mol1-(2-Bromoethoxy)-4-methoxybenzene
CAS:1-(2-Bromoethoxy)-4-methoxybenzene is a compound that has various applications in different industries. It is commonly used in the synthesis of histidine, an essential amino acid, and collagen, a protein found in connective tissues. This compound can also be used as a reactant in industrial processes and as a reagent for the synthesis of other chemicals.
Formula:C9H11BrO2Purity:Min. 95%Molecular weight:231.09 g/mol



