CAS 2293-21-2

3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,2-dimethylpropan-1-amine

Description:

3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,2-dimethylpropan-1-amine, with the CAS number 2293-21-2, is a chemical compound that belongs to the class of dibenzoazepines. This substance features a complex bicyclic structure, which contributes to its unique pharmacological properties. It typically exhibits characteristics such as a relatively high molecular weight and specific stereochemistry due to the presence of multiple chiral centers. The compound is often studied for its potential psychoactive effects and may interact with various neurotransmitter systems in the brain, making it of interest in medicinal chemistry and pharmacology. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in research and potential therapeutic uses. Safety and handling precautions are essential when working with this compound, as with many organic amines, due to possible toxicity and reactivity. Overall, its structural complexity and biological activity make it a subject of ongoing research in the field of drug development.

Formula: C₁₉H₂₄N₂

InChI: InChI=1/C19H24N2/c1-15(13-20-2)14-21-18-9-5-3-7-16(18)11-12-17-8-4-6-10-19(17)21/h3-10,15,20H,11-14H2,1-2H3

SMILES: CC(CNC)CN1c2ccccc2CCc2ccccc12

Synonyms:

• 3-(10,11-Dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,2-dimethyl-1-propanamine
• 5H-Dibenz(b,f)azepine-5-propanamine, 10,11-dihydro-N,beta-dimethyl-

N-DESMETHYLTRIMIPRAMINE,1.0MG/MLINMETHANOL

CAS: 2293-21-2

Formula: C₁₉H₂₄N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 280.4073

Ref: IN-DA00C2V8

N-Desmethyltrimipramine

CAS: 2293-21-2

N-Desmethyltrimipramine

Purity: ≥98%

Molecular weight: 280.41g/mol

Ref: 54-BUP07773

N-Desmethyltrimipramine

CAS: 2293-21-2

N-Desmethyltrimipramine is a biochemical.

Formula: C₁₉H₂₄N₂

Purity: 99.54%

Color and Shape: Solid

Molecular weight: 280.41

Ref: TM-T9128

Trimipramine Maleate EP Impurity B

CAS: 2293-21-2

Formula: C₁₉H₂₄N₂

Molecular weight: 280.41

Ref: ST-EA-CP-T68003