CAS 229323-07-3

1-[(3S)-1-benzylpyrrolidin-3-yl]methanamine

Description:

1-[(3S)-1-benzylpyrrolidin-3-yl]methanamine, with the CAS number 229323-07-3, is a chemical compound characterized by its unique structural features. It contains a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a benzyl group, which contributes to its hydrophobic characteristics. The presence of the amine functional group indicates that it can participate in hydrogen bonding, making it potentially soluble in polar solvents. The stereochemistry of the compound is significant, as the (3S) configuration suggests specific spatial arrangements that can influence its biological activity and interactions with receptors. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. Its molecular structure suggests potential applications in areas such as neuropharmacology or as a building block for more complex molecules. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential therapeutic effects.

Formula: C₁₂H₁₈N₂

InChI: InChI=1/C12H18N2/c13-8-12-6-7-14(10-12)9-11-4-2-1-3-5-11/h1-5,12H,6-10,13H2/t12-/m0/s1

SMILES: c1ccc(cc1)CN1CC[C@@H](CN)C1

Synonyms:

• (3S)-3-Aminomethyl-1-benzylpyrrolidine
• 3-Pyrrolidinemethanamine, 1-(phenylmethyl)-, (3S)-

(S)-(1-Benzylpyrrolidin-3-yl)methanamine

CAS: 229323-07-3

Formula: C₁₂H₁₈N₂

Molecular weight: 190.2847

Ref: IN-DA002LJV

(S)-3-Aminomethyl-1-benzylpyrrolidine

CAS: 229323-07-3

(S)-3-Aminomethyl-1-benzylpyrrolidine

Purity: 95%

Molecular weight: 190.28g/mol

Ref: 54-OR913943