CAS 22934-41-4
:Quinoline-5-carbaldehyde
Description:
Quinoline-5-carbaldehyde is an organic compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. This compound features an aldehyde functional group (-CHO) at the 5-position of the quinoline ring, which contributes to its reactivity and potential applications in organic synthesis. Quinoline-5-carbaldehyde is typically a yellow to brown liquid or solid, depending on its purity and form. It is known for its aromatic properties and can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound is of interest in medicinal chemistry and materials science due to its potential biological activities and utility as a building block in the synthesis of more complex molecules. Additionally, it may exhibit fluorescence, making it useful in certain analytical applications. As with many organic compounds, proper handling and safety precautions should be observed, as it may pose health risks if inhaled or ingested.
Formula:C10H7NO
InChI:InChI=1/C10H7NO/c12-7-8-3-1-5-10-9(8)4-2-6-11-10/h1-7H
SMILES:c1cc(C=O)c2cccnc2c1
Synonyms:- Quinoline-5-carboxaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Quinoline-5-carboxaldehyde, 97+%
CAS:Quinoline-5-carboxaldehyde is used as a precursor in the preparation of pharmaceuticals. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product /
Formula:C10H7NOPurity:97+%Color and Shape:Cream to yellow to brown, Crystals or powder or crystalline powderMolecular weight:157.17




