CAS 22944-67-8
:1-benzylimidazol-2-amine
Description:
1-Benzylimidazol-2-amine is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a benzyl group attached to the nitrogen atom of the imidazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine functional group. The compound can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions, making it of interest in medicinal chemistry and materials science. Its potential applications may include use as a building block in the synthesis of pharmaceuticals or as a ligand in coordination chemistry. Additionally, the presence of both aromatic and heterocyclic components may influence its biological activity, making it a candidate for further research in drug development. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H11N3
InChI:InChI=1/C10H11N3/c11-10-12-6-7-13(10)8-9-4-2-1-3-5-9/h1-7H,8H2,(H2,11,12)
SMILES:c1ccc(cc1)Cn1cc[nH]c1=N
Synonyms:- 1-Benzyl-1H-imidazol-2-amine
- 1-Benzyl-1H-imidazol-2-ylamine
- 1H-imidazol-2-amine, 1-(phenylmethyl)-
- 2-Amino-1-Benzylimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
