CAS 22945-63-7
:(2-methoxyphenyl)(pyridin-2-yl)methanone
Description:
(2-methoxyphenyl)(pyridin-2-yl)methanone, with the CAS number 22945-63-7, is an organic compound characterized by its unique structure, which includes a methoxy group attached to a phenyl ring and a pyridine ring. This compound typically exhibits properties associated with both aromatic systems, such as stability and the ability to engage in various chemical reactions, including electrophilic substitution. The presence of the methoxy group can influence its reactivity and solubility, often enhancing its lipophilicity and potentially affecting its biological activity. The pyridine moiety contributes to the compound's basicity and can participate in coordination with metal ions. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Its physical properties, such as melting point and solubility, would depend on the specific conditions and solvent used. Overall, (2-methoxyphenyl)(pyridin-2-yl)methanone represents a versatile structure in organic synthesis and pharmaceutical research.
Formula:C13H11NO2
InChI:InChI=1/C13H11NO2/c1-16-12-8-3-2-6-10(12)13(15)11-7-4-5-9-14-11/h2-9H,1H3
SMILES:COc1ccccc1C(=O)c1ccccn1
Synonyms:- Ketone, o-methoxyphenyl 2-pyridyl
- Methanone, (2-Methoxyphenyl)-2-Pyridinyl-
- (2-Methoxyphenyl)(pyridin-2-yl)methanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(2-Methoxybenzoyl)pyridine
CAS:2-(2-Methoxybenzoyl)pyridine is a synthetic compound that is a 5-HT1A receptor agonist. It has been shown to stimulate the release of guanosine from ovary cells, which may be due to its ability to activate the G protein. 2-(2-Methoxybenzoyl)pyridine has been shown to inhibit the effects of antipsychotic haloperidol in vitro and in vivo. This may be due to its ability to antagonize the 5-HT1A receptor. This drug also inhibits ovary cell proliferation and induces apoptosis, which may be related to its ability to inhibit protein synthesis by binding with ribosomes and preventing translation.
Formula:C13H11NO2Purity:Min. 95%Molecular weight:213.23 g/mol


