CAS 2295-06-9
:1,3-Bis(chlorodimethylsilyl)propane
Description:
1,3-Bis(chlorodimethylsilyl)propane, with the CAS number 2295-06-9, is an organosilicon compound characterized by the presence of two chlorodimethylsilyl groups attached to a propane backbone. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of chlorine atoms, which can undergo nucleophilic substitution reactions. The dimethylsilyl groups contribute to its hydrophobic properties, making it useful in various applications, including as a coupling agent in silicone chemistry and as a precursor in the synthesis of siloxane polymers. Its structure allows for potential cross-linking in polymer matrices, enhancing material properties. Additionally, the compound is sensitive to moisture, which can lead to hydrolysis, releasing hydrochloric acid and forming silanol groups. Safety precautions should be taken when handling this substance, as it can be harmful if inhaled or absorbed through the skin. Proper storage in a cool, dry place is recommended to maintain its stability and reactivity.
Formula:C7H18Cl2Si2
InChI:InChI=1/C7H18Cl2Si2/c1-10(2,8)6-5-7-11(3,4)9/h5-7H2,1-4H3
SMILES:C[Si](C)(CCC[Si](C)(C)Cl)Cl
Synonyms:- Propane-1,3-Diylbis[Chloro(Dimethyl)Silane]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.