CAS 2295-58-1: Flopropione
Description:Flopropione, with the CAS number 2295-58-1, is a chemical compound that belongs to the class of propionic acid derivatives. It is characterized by its unique molecular structure, which includes a propionic acid backbone modified with specific functional groups that impart distinct properties. Flopropione is typically recognized for its applications in various fields, including pharmaceuticals and agrochemicals. The compound may exhibit properties such as moderate solubility in organic solvents and potential reactivity with other chemical species, depending on its functional groups. Its safety profile, including toxicity and environmental impact, would need to be assessed through specific studies, as with any chemical substance. Additionally, the compound's stability under different conditions, such as temperature and pH, is crucial for its handling and storage. Overall, Flopropione represents a notable example of synthetic organic chemistry with potential utility in diverse applications.
Formula:C9H10O4
InChI:InChI=1S/C9H10O4/c1-2-6(11)9-7(12)3-5(10)4-8(9)13/h3-4,10,12-13H,2H2,1H3
InChI key:InChIKey=PTHLEKANMPKYDB-UHFFFAOYSA-N
SMILES:O=C(C=1C(O)=CC(O)=CC1O)CC
- Synonyms:
- 1-(2,4,6-Trihydroxyphenyl)-1-propanone
- 1-(2,4,6-Trihydroxyphenyl)Propan-1-One
- 1-Propanone, 1-(2,4,6-trihydroxyphenyl)-
- 13907 R. P.
- 2,4,6-Trihydroxypropiophenone
- Argobyl
- Cospanon
- Flopion
- Flopropion
- Gallepronin
- See more synonyms
- Gasstenon
- Labroda
- Labrodax
- Labrodax supanate
- NSC 97909
- Pasmus
- Phloropropionone
- Phloropropiophenone
- Profenon
- Propionylphloroglucinol
- Propiophenone, 2′,4′,6′-trihydroxy-
- Propiophloroglucine
- Rp 13907
- Spamorin
- Spasmoril
- Supanate
- Supazlun
- Flopropione
