CAS 22951-94-6
:L-Phenylalanyl-L-isoleucine
Description:
L-Phenylalanyl-L-isoleucine, with the CAS number 22951-94-6, is a dipeptide composed of the amino acids phenylalanine and isoleucine linked by a peptide bond. This compound is characterized by its specific sequence, where phenylalanine (an aromatic amino acid) is positioned at the N-terminus and isoleucine (a branched-chain amino acid) at the C-terminus. It is typically a white to off-white solid that is soluble in water and exhibits a relatively stable structure under physiological conditions. The presence of the aromatic side chain from phenylalanine contributes to its hydrophobic characteristics, while isoleucine adds to the overall hydrophobicity of the molecule. L-Phenylalanyl-L-isoleucine may play a role in various biological processes, including protein synthesis and cellular signaling. Its properties make it of interest in biochemical research and potential applications in pharmaceuticals and nutrition. As with many peptides, its stability and activity can be influenced by factors such as pH, temperature, and the presence of other ions or molecules.
Formula:C15H22N2O3
InChI:InChI=1/C15H22N2O3/c1-3-10(2)13(15(19)20)17-14(18)12(16)9-11-7-5-4-6-8-11/h4-8,10,12-13H,3,9,16H2,1-2H3,(H,17,18)(H,19,20)
SMILES:CCC(C)C(C(=O)O)N=C(C(Cc1ccccc1)N)O
Synonyms:- H-Phe-Ile-OH
- Phenylalanylisoleucine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
H-Phe-Ile-OH
CAS:<p>Bachem ID: 4014224.</p>Formula:C15H22N2O3Purity:> 97%Color and Shape:White PowderMolecular weight:278.35L-Isoleucine, L-phenylalanyl-
CAS:Formula:C15H22N2O3Purity:99%Color and Shape:SolidMolecular weight:278.3468(2S,3S)-2-((S)-2-Amino-3-phenylpropanamido)-3-methylpentanoic acid
CAS:<p>(2S,3S)-2-((S)-2-Amino-3-phenylpropanamido)-3-methylpentanoic acid</p>Purity:99%Molecular weight:278.35g/molH-Phe-Ile-OH
CAS:<p>H-Phe-Ile-OH is a compound with amide functional group. It has been found to be a potential biomarker for endometriosis, with the ability to bind to monoclonal antibodies that are designed to detect specific markers of the disease. This molecule has also been shown to have diagnostic properties, as well as the ability to inhibit protein synthesis in infectious diseases. H-Phe-Ile-OH is an amino acid derivative and may be used as a biochemical diagnostic in caco-2 cells.</p>Formula:C15H22N2O3Purity:Min. 95%Molecular weight:278.35 g/mol




