CAS 22952-19-8

2-methyl-4-nitrobenzenesulfonamide

Description:

2-Methyl-4-nitrobenzenesulfonamide, with the CAS number 22952-19-8, is an organic compound characterized by its sulfonamide functional group attached to a benzene ring that also features a methyl group and a nitro group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the sulfonamide group, which enhances its polarity. The nitro group contributes to its electron-withdrawing properties, influencing its reactivity and potential applications in organic synthesis. 2-Methyl-4-nitrobenzenesulfonamide can serve as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its structural features may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's stability under standard conditions and its ability to participate in electrophilic aromatic substitution reactions are notable characteristics that facilitate its use in further chemical transformations. Safety data should be consulted for handling and usage, as sulfonamides can exhibit varying degrees of toxicity and environmental impact.

Formula: C₇H₈N₂O₄S

InChI: InChI=1/C7H8N2O4S/c1-5-4-6(9(10)11)2-3-7(5)14(8,12)13/h2-4H,1H3,(H2,8,12,13)

SMILES: Cc1cc(ccc1S(=O)(=O)N)N(=O)=O

Synonyms:

• 2-Methyl-4-Nitrobenzene-1-Sulfonamide

2-Methyl-4-nitrobenzene-1-sulfonamide

CAS: 22952-19-8

Versatile small molecule scaffold

Formula: C₇H₈N₂O₄S

Purity: Min. 95%

Molecular weight: 216.22 g/mol

Ref: 3D-XAA95219