CAS 22955-77-7
:methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylate
Description:
Methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylate, with the CAS number 22955-77-7, is an organic compound characterized by its unique bicyclic structure, which includes an indene moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It features a carbonyl group (ketone) and an ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of these functional groups makes it a versatile intermediate in the synthesis of various pharmaceuticals and agrochemicals. Methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylate is known for its moderate solubility in organic solvents, while its stability can vary based on environmental conditions such as temperature and exposure to light. Safety data indicates that, like many organic compounds, it should be handled with care, utilizing appropriate safety measures to avoid inhalation or skin contact. Overall, this compound is of interest in the field of synthetic organic chemistry due to its structural features and potential utility in various chemical reactions.
Formula:C11H10O3
InChI:InChI=1/C11H10O3/c1-14-11(13)9-6-7-4-2-3-5-8(7)10(9)12/h2-5,9H,6H2,1H3
SMILES:COC(=O)C1Cc2ccccc2C1=O
Synonyms:- 1H-Indene-2-carboxylic acid, 2,3-dihydro-1-oxo-, methyl ester
- Methyl 1-oxo-2-indanecarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Oxo-indan-2-carboxylic acid methyl ester
CAS:Formula:C11H10O3Purity:96%Color and Shape:SolidMolecular weight:190.1953Methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylate
CAS:Methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylatePurity:99%Molecular weight:190.20g/molMethyl 1-Oxo-2,3-dihydro-1H-indene-2-carboxylate
CAS:Formula:C11H10O3Purity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:190.20METHYL 1-OXO-2,3-DIHYDRO-1H-INDENE-2-CARBOXYLATE
CAS:Formula:C11H10O3Purity:96%Molecular weight:190.198Methyl 1-Oxo-2,3-dihydro-1H-indene-2-carboxylate
CAS:Controlled ProductFormula:C11H10O3Color and Shape:NeatMolecular weight:190.195




