CAS 22958-64-1
:Benzeneacetic acid, 4-(aminosulfonyl)-
Description:
Benzeneacetic acid, 4-(aminosulfonyl)-, also known as 4-Aminobenzenesulfonic acid, is an aromatic compound characterized by the presence of both a benzene ring and a carboxylic acid functional group. This compound features a sulfonamide group (-SO2NH2) attached to the benzene ring, which contributes to its unique chemical properties. It is typically a white to off-white solid that is soluble in water and polar organic solvents. The presence of the amino and sulfonyl groups enhances its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and dyes. The compound may exhibit biological activity, potentially serving as an intermediate in the synthesis of other biologically active molecules. Its chemical structure allows for hydrogen bonding, influencing its solubility and interaction with other substances. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken during use.
Formula:C8H9NO4S
InChI:InChI=1S/C8H9NO4S/c9-14(12,13)7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11)(H2,9,12,13)
InChI key:ONVURFJRZJXWDD-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1CC(=O)O)S(=O)(=O)N
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-(4-Sulfamoylphenyl)acetic acid
CAS:2-(4-Sulfamoylphenyl)acetic acidFormula:C8H9NO4SPurity:95%Color and Shape:SolidMolecular weight:215.234-(Aminosulfonyl)benzeneacetic acid
CAS:Formula:C8H9NO4SPurity:97%Color and Shape:SolidMolecular weight:215.22642-(4-Sulfamoylphenyl)acetic acid
CAS:2-(4-Sulfamoylphenyl)acetic acidFormula:C8H9NO4SPurity:97%Molecular weight:215.23(4-Sulfamoyl-phenyl)-acetic acid
CAS:4-Sulfamoyl-phenylacetic acid (SPAA) is a potent and selective Cox-2 inhibitor. SPAA has been found to inhibit the polymerase activity of the virus, leading to apoptosis. This drug also inhibits the COX-2 enzyme and prevents the formation of prostaglandins, which are inflammatory mediators. SPAA has shown inhibitory activities against prostate cancer cells and may be effective in treating prostate cancer. SPAA also inhibits COX-2 enzyme activity in human prostate cancer cells, suggesting that it may be useful for preventing metastasis.Formula:C8H9NO4SPurity:Min. 95%Molecular weight:215.23 g/mol




