CAS 22959-81-5
:1,2-Dihydro-1-hydroxy-2-[(4-methylphenyl)sulfonyl]-2,3,1-benzodiazaborine
Description:
1,2-Dihydro-1-hydroxy-2-[(4-methylphenyl)sulfonyl]-2,3,1-benzodiazaborine, with CAS number 22959-81-5, is a chemical compound that belongs to the class of benzodiazaborines, which are characterized by the incorporation of boron into the benzodiazole structure. This compound features a sulfonyl group attached to a 4-methylphenyl moiety, contributing to its unique chemical properties. The presence of the hydroxyl group indicates potential for hydrogen bonding, which may influence its solubility and reactivity. The boron atom in the structure can participate in coordination chemistry, making it of interest in various applications, including materials science and medicinal chemistry. The compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, this compound's unique structure and functional groups suggest potential utility in synthetic chemistry and as a building block for more complex molecules.
Formula:C14H13BN2O3S
InChI:InChI=1S/C14H13BN2O3S/c1-11-6-8-13(9-7-11)21(19,20)17-15(18)14-5-3-2-4-12(14)10-16-17/h2-10,18H,1H3
InChI key:InChIKey=UQIDNSKBUXCODH-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1B(O)C=2C(C=N1)=CC=CC2)C3=CC=C(C)C=C3
Synonyms:- 2,3,1-Benzodiazaborine, 1,2-dihydro-1-hydroxy-2-(p-tolylsulfonyl)-
- 2,3,1-Benzodiazaborine, 1,2-dihydro-1-hydroxy-2-[(4-methylphenyl)sulfonyl]-
- 1,2-Dihydro-1-hydroxy-2-[(4-methylphenyl)sulfonyl]-2,3,1-benzodiazaborine
- Diazaborine
- 1,2-Dihydro-1-hydroxy-2-(p-tosyl)-2,3,1-benzo[e]diazaborine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Diazaborine
CAS:Controlled Product<p>Applications Diazaborine is an antibacterial drug that inhibits enoyl-ACP reductase in Escherichia coli. Diazaborine treatment of yeast inhibits processing of the rRNA precursors for the large ribosomal subunit.<br>References Levy, C., et al.: J. Mol. Biol., 309, 171 (2001); Pertschy, B., et al.: Mol. Cell. Biol., 24, 6476 (2004);<br></p>Formula:C14H13BN2O3SColor and Shape:NeatMolecular weight:300.14Diazaborine
CAS:Diazaborine is an analog of the cyclin-dependent kinase inhibitor and has been shown to have anticancer properties. It induces apoptosis in tumor cells by inhibiting the activity of specific kinases involved in cell division. Diazaborine has been studied extensively in Chinese hamster ovary cells and human urine protein, showing potent inhibition of these kinases. This drug may be useful for the treatment of various types of cancer. Additionally, Diazaborine has been shown to act as a potent inhibitor of other proteins involved in cell signaling pathways, making it a promising candidate for future drug development.Formula:C14H13BN2O3SPurity:Min. 95%Color and Shape:PowderMolecular weight:300.14 g/molDiazaborine
CAS:Diazaborine disrupts large ribosome formation by inhibiting rRNA maturation and AAA-ATPase Drg1, leading to rapid protein redistribution.Formula:C14H13BN2O3SPurity:98%Color and Shape:SolidMolecular weight:300.14


