CAS 229615-05-8

Methyl (1S,2S,3R,4R)-3-[(1R)-1-acetamido-2-ethylbutyl]-4-amino-2-hydroxycyclopentanecarboxylate

Description:

Methyl (1S,2S,3R,4R)-3-[(1R)-1-acetamido-2-ethylbutyl]-4-amino-2-hydroxycyclopentanecarboxylate, with CAS number 229615-05-8, is a complex organic compound characterized by its cyclopentane structure, which includes multiple functional groups such as an acetamido group, an amino group, and a hydroxy group. This compound is notable for its stereochemistry, indicated by the specific (S) and (R) configurations at various chiral centers, which can significantly influence its biological activity and interactions. The presence of the methyl ester group suggests it may exhibit properties typical of esters, such as solubility in organic solvents and potential reactivity in hydrolysis reactions. Additionally, the compound's structure implies potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various biochemical interactions. Overall, its unique structural features and stereochemistry contribute to its potential utility in various chemical and biological contexts.

Formula: C₁₅H₂₈N₂O₄

InChI: InChI=1S/C15H28N2O4/c1-5-9(6-2)13(17-8(3)18)12-11(16)7-10(14(12)19)15(20)21-4/h9-14,19H,5-7,16H2,1-4H3,(H,17,18)/t10-,11+,12+,13?,14+/m0/s1

Synonyms:

• (1S,2S,3R,4R)-Methyl 3-((R)-1-acetamido-2-ethylbutyl)-4-amino-2-hydroxycyclopentanecarboxylate

(1S,2S,3R,4R)-Methyl 3-((R)-1-acetaMido-2-ethylbutyl)-4-aMino-2-hydroxycyclopentanecarboxylate

CAS: 229615-05-8

Formula: C₁₅H₂₈N₂O₄

Molecular weight: 300.3938

Ref: IN-DA002LPK

Peramivir Impurity 6

CAS: 229615-05-8

Formula: C₁₅H₂₈N₂O₄

Color and Shape: White To Off-White Solid

Molecular weight: 300.40

Ref: 4Z-P-124010