CAS 22962-49-8

(5-methyl-1-benzothiophen-2-yl)methanol

Description:

(5-methyl-1-benzothiophen-2-yl)methanol, with the CAS number 22962-49-8, is an organic compound characterized by its unique structure that includes a benzothiophene moiety and a hydroxymethyl group. This compound features a methyl group at the 5-position of the benzothiophene ring, which contributes to its chemical properties and potential biological activity. The presence of the hydroxymethyl group indicates that it can participate in various chemical reactions, such as oxidation or substitution, making it a versatile intermediate in organic synthesis. The compound is likely to exhibit moderate solubility in organic solvents due to its aromatic structure, while its polar hydroxymethyl group may enhance its solubility in polar solvents. Additionally, compounds of this type may possess interesting pharmacological properties, making them of interest in medicinal chemistry. However, specific data regarding its reactivity, stability, and biological effects would require further investigation through experimental studies.

Formula: C₁₀H₁₀OS

InChI: InChI=1/C10H10OS/c1-7-2-3-10-8(4-7)5-9(6-11)12-10/h2-5,11H,6H2,1H3

SMILES: Cc1ccc2c(c1)cc(CO)s2

Synonyms:

• (5-Methyl-1-Benzothien-2-Yl)Methanol
• 5-Methylbenzo[B]Thiophene-2-Methanol
• Benzo[b]thiophene-2-methanol, 5-methyl-

5-Methylbenzo[B]Thiophene-2-Methanol

CAS: 22962-49-8

Formula: C₁₀H₁₀OS

Purity: 95%

Color and Shape: Solid

Molecular weight: 178.2508

Ref: IN-DA002LPV

(5-Methylbenzo[b]thiophen-2-yl)methanol

CAS: 22962-49-8

(5-Methylbenzo[b]thiophen-2-yl)methanol

Purity: 95%

Molecular weight: 178.25g/mol

Ref: 54-OR346466

(5-Methyl-benzo[b]thiophen-2-yl)-methanol

CAS: 22962-49-8

Formula: C₁₀H₁₀OS

Purity: 95.0%

Molecular weight: 178.25

Ref: 10-F025287