CAS 229621-30-1
:(3R,4R)-1-hydroxy-2,2,5,5-tetramethyl-3,4-bis(methylsulfonylsulfanylmethyl)pyrrolidine
Description:
(3R,4R)-1-hydroxy-2,2,5,5-tetramethyl-3,4-bis(methylsulfonylsulfanylmethyl)pyrrolidine, with CAS number 229621-30-1, is a complex organic compound characterized by its unique pyrrolidine ring structure. This compound features multiple functional groups, including a hydroxyl group and bis(methylsulfonylsulfanylmethyl) substituents, which contribute to its chemical reactivity and potential biological activity. The presence of the tetramethyl groups enhances its steric properties, while the methylsulfonyl groups may impart solubility and polarity characteristics. The stereochemistry indicated by the (3R,4R) configuration suggests specific spatial arrangements that can influence the compound's interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve advanced organic synthesis techniques, and it may exhibit properties relevant to pharmaceuticals or agrochemicals. Further studies would be necessary to elucidate its full range of chemical behavior, potential applications, and safety profile.
Formula:C12H25NO5S4
InChI:InChI=1/C12H25NO5S4/c1-11(2)9(7-19-21(5,15)16)10(8-20-22(6,17)18)12(3,4)13(11)14/h9-10,14H,7-8H2,1-6H3/t9-,10-/m1/s1
SMILES:CC1(C)[C@H](CSS(=O)(=O)C)[C@@H](CSS(=O)(=O)C)C(C)(C)N1O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Trans-3,4-Bis[[(methylsulfonyl)thio]methyl]-2,2,5,5-tetramethylpyrrolidin-1-yloxyl Radical
CAS:Formula:C12H24NO5S4Color and Shape:SolidMolecular weight:390.5827Trans-3,4-Bis[[(methylsulfonyl)thio]methyl]-2,2,5,5-tetramethylpyrrolidin-1-yloxyl Radical
CAS:Controlled Product<p>Applications A cross-linking sulfhydryl spin label.<br>References Kalai, T., et al.: Synthesis, 6, 973 (1999)<br></p>Formula:C12H24NO5S4Color and Shape:NeatMolecular weight:390.58

