CymitQuimica logo

CAS 229623-53-4

:

3-Amino-1,2-benzisoxazole-6-carbonitrile

Description:
3-Amino-1,2-benzisoxazole-6-carbonitrile is a heterocyclic organic compound characterized by the presence of both an amino group and a carbonitrile group attached to a benzisoxazole ring system. This compound features a fused bicyclic structure that includes a five-membered isoxazole ring and a six-membered benzene ring, contributing to its unique chemical properties. The amino group typically imparts basic characteristics, allowing for potential interactions with acids and other electrophiles. The carbonitrile group, known for its strong electron-withdrawing properties, enhances the compound's reactivity and can influence its solubility and stability. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the presence of both functional groups allows for further derivatization, which can lead to the synthesis of novel compounds with tailored properties. Overall, 3-Amino-1,2-benzisoxazole-6-carbonitrile is a versatile compound with significant implications in chemical research and application.
Formula:C8H5N3O
InChI:InChI=1S/C8H5N3O/c9-4-5-1-2-6-7(3-5)12-11-8(6)10/h1-3H,(H2,10,11)
InChI key:InChIKey=OCJIURFDSUKEMM-UHFFFAOYSA-N
SMILES:NC=1C=2C(=CC(C#N)=CC2)ON1
Synonyms:
  • 1,2-Benzisoxazole-6-Carbonitrile, 3-Amino-
  • 3-Amino-1,2-benzisoxazole-6-carbonitrile
  • 3-Amino-6-cyano-1,2-benzisoxazole
  • 3-Aminobenzo[d]isoxazole-6-carbonitrile
  • 3-Amino-1,2-benzoxazole-6-carbonitrile
  • 3-Amino-1,2-benzoxazole-6-carbonitrile
Found 4 products.