
CAS 229634-98-4
:TAS 108
Description:
TAS 108, with the CAS number 229634-98-4, is a chemical compound that has garnered attention in various fields, particularly in medicinal chemistry and pharmacology. It is characterized as a selective antagonist of certain receptors, which may contribute to its potential therapeutic applications. The compound typically exhibits a specific molecular structure that influences its biological activity, including its affinity for target receptors and its pharmacokinetic properties. While detailed information on its solubility, stability, and reactivity may vary, compounds of this nature often demonstrate moderate to high stability under standard laboratory conditions. Additionally, TAS 108 may undergo metabolic processes that affect its efficacy and safety profile. As with many chemical substances, understanding its characteristics requires careful consideration of its synthesis, mechanism of action, and potential side effects. Researchers continue to explore its applications, particularly in the context of treating specific medical conditions, making it a subject of ongoing study in the scientific community.
Formula:C33H47NO3·C6H8O7
InChI:InChI=1S/C33H47NO3.C6H8O7/c1-6-34(7-2)21-23-8-13-30(31(19-23)36-5)37-17-15-25-9-12-29-32-22(3)18-24-20-26(35)10-11-27(24)28(32)14-16-33(25,29)4;7-3(8)1-6(13,5(11)12)2-4(9)10/h8,10-11,13,19-20,22,25,28-29,32,35H,6-7,9,12,14-18,21H2,1-5H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t22-,25-,28-,29+,32-,33-;/m1./s1
InChI key:InChIKey=VOHOCSJONOJOSD-SCIDSJFVSA-N
SMILES:C[C@H]1[C@]2([C@]3([C@@](C)([C@@H](CCOC4=C(OC)C=C(CN(CC)CC)C=C4)CC3)CC[C@@]2(C=5C(C1)=CC(O)=CC5)[H])[H])[H].C(CC(O)=O)(CC(O)=O)(C(O)=O)O
Synonyms:- 19-Norpregna-1,3,5(10)-trien-3-ol, 21-[4-[(diethylamino)methyl]-2-methoxyphenoxy]-7-methyl-, (7α)-, 2-hydroxy-1,2,3-propanetricarboxylate (1:1) (salt)
- TAS 108
- HLX 801
- SR 16234
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(7α)-21-[4-[(Diethylamino)methyl]-2-methoxyphenoxy]-7-methyl-19-norpregna-1,3,5(10)-trien-3-ol 2-Hydroxy-1,2,3-propanetricarboxylate Salt (1:1)
CAS:Controlled ProductFormula:C33H47NO3·C6H8O7Color and Shape:NeatMolecular weight:697.855TAS-108 citrate
CAS:TAS-108 (SR16234) is a steroidal antiestrogen that inhibits ERa to deter estrogen-dependent tumor growth and partially activates ERb.Formula:C39H55NO10Color and Shape:SolidMolecular weight:697.86

