CAS 22966-26-3

1-(3-bromophenyl)-3-phenylprop-2-en-1-one

Description:

1-(3-bromophenyl)-3-phenylprop-2-en-1-one, with the CAS number 22966-26-3, is an organic compound characterized by its structure, which features a conjugated system that includes a bromophenyl group and a phenyl group attached to a prop-2-en-1-one moiety. This compound typically exhibits properties associated with α,β-unsaturated carbonyl compounds, such as reactivity in Michael addition reactions and potential for electrophilic aromatic substitution due to the presence of the bromine substituent. The bromine atom enhances the electrophilicity of the aromatic ring, making it more reactive towards nucleophiles. Additionally, the compound may display significant UV-Vis absorption characteristics due to its conjugated double bond system, which can be useful in various applications, including organic synthesis and materials science. Its solubility and stability can vary depending on the solvent and environmental conditions. Overall, this compound is of interest in synthetic organic chemistry and may have potential applications in pharmaceuticals and agrochemicals.

Formula: C₁₅H₁₁BrO

InChI: InChI=1/C15H11BrO/c16-14-8-4-7-13(11-14)15(17)10-9-12-5-2-1-3-6-12/h1-11H

(2E)-1-(3-bromophenyl)-3-phenylprop-2-en-1-one

CAS: 22966-26-3

Formula: C₁₅H₁₁BrO

Purity: 95.0%

Molecular weight: 287.156

Ref: 10-F524113