CAS 2297-65-6
:Benzenesulfonyl bromide
Description:
Benzenesulfonyl bromide, with the CAS number 2297-65-6, is an organic compound characterized by the presence of a sulfonyl group (-SO2-) attached to a benzene ring, along with a bromine atom. It typically appears as a colorless to pale yellow liquid and has a pungent odor. This compound is known for its reactivity, particularly as a sulfonylating agent in organic synthesis, where it can introduce the benzenesulfonyl group into various substrates. Benzenesulfonyl bromide is soluble in organic solvents such as dichloromethane and ether but is generally insoluble in water. It is sensitive to moisture and can hydrolyze in the presence of water, forming benzenesulfonic acid and hydrobromic acid. Due to its reactivity, it should be handled with care, as it can cause irritation to the skin, eyes, and respiratory system. In laboratory settings, it is often utilized in the preparation of sulfonamides and other sulfonyl derivatives, making it a valuable reagent in synthetic organic chemistry.
Formula:C6H5BrO2S
InChI:InChI=1S/C6H5BrO2S/c7-10(8,9)6-4-2-1-3-5-6/h1-5H
InChI key:InChIKey=CGWWQPZGKPHLBU-UHFFFAOYSA-N
SMILES:S(Br)(=O)(=O)C1=CC=CC=C1
Synonyms:- Benzenesulfonyl bromide
- Phenylsulfonyl bromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
