CymitQuimica logo

CAS 22976-87-0

:

1-[(2R,3R,4S,5R)-5-[1-[(2-amino-5-carbamoyloxy-4-hydroxy-pentanoyl)amino]-2-hydroxy-2-oxo-ethyl]-3,4-dihydroxy-tetrahydrofuran-2-yl]-2,4-dioxo-pyrimidine-5-carboxylic acid

Description:
The chemical substance with the name "1-[(2R,3R,4S,5R)-5-[1-[(2-amino-5-carbamoyloxy-4-hydroxy-pentanoyl)amino]-2-hydroxy-2-oxo-ethyl]-3,4-dihydroxy-tetrahydrofuran-2-yl]-2,4-dioxo-pyrimidine-5-carboxylic acid" and CAS number 22976-87-0 is a complex organic compound characterized by its intricate structure, which includes multiple functional groups such as amino, hydroxyl, and carboxylic acid moieties. This compound is notable for its stereochemistry, featuring several chiral centers that contribute to its potential biological activity. It is likely to exhibit solubility in polar solvents due to the presence of hydroxyl and amino groups, which can engage in hydrogen bonding. The pyrimidine and tetrahydrofuran components suggest potential roles in biochemical pathways, possibly as a metabolite or a precursor in nucleic acid synthesis. Its specific interactions and applications would depend on further studies, including its pharmacological properties and mechanisms of action in biological systems. Overall, this compound represents a significant interest in medicinal chemistry and biochemistry due to its structural complexity and potential therapeutic implications.
Formula:C17H23N5O13
InChI:InChI=1/C17H23N5O13/c18-6(1-4(23)3-34-16(19)32)12(27)20-7(15(30)31)10-8(24)9(25)13(35-10)22-2-5(14(28)29)11(26)21-17(22)33/h2,4,6-10,13,23-25H,1,3,18H2,(H2,19,32)(H,20,27)(H,28,29)(H,30,31)(H,21,26,33)/t4?,6?,7?,8-,9+,10+,13+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Polyoxin E

    CAS:
    Polyoxin E is a nucleoside antifungal antibiotic that demonstrates significant effectiveness against rice sheath blight.
    Formula:C17H23N5O13
    Color and Shape:Solid
    Molecular weight:505.39

    Ref: TM-TN10958

    10mg
    To inquire
    50mg
    To inquire