CymitQuimica logo

CAS 22976-88-1

:

{[2-amino-5-(carbamoyloxy)-4-hydroxypentanoyl]amino}{3,4-dihydroxy-5-[5-(hydroxymethyl)-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl]tetrahydrofuran-2-yl}acetic acid (non-preferred name)

Description:
The chemical substance with the name "{[2-amino-5-(carbamoyloxy)-4-hydroxypentanoyl]amino}{3,4-dihydroxy-5-[5-(hydroxymethyl)-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl]tetrahydrofuran-2-yl}acetic acid" and CAS number 22976-88-1 is a complex organic compound characterized by its multi-functional groups, including amino, hydroxyl, and carbamoyloxy moieties. This structure suggests potential biological activity, possibly as a pharmaceutical agent or a biochemical probe. The presence of a tetrahydrofuran ring indicates a cyclic structure that may contribute to its stability and reactivity. Additionally, the compound features a pyrimidine derivative, which is often associated with nucleic acid metabolism and various enzymatic processes. Its solubility and reactivity can be influenced by the functional groups present, making it a candidate for interactions in biological systems. Overall, this compound's intricate structure and diverse functional groups suggest it may play a role in medicinal chemistry or biochemistry, although specific applications would depend on further research and characterization.
Formula:C17H25N5O12
InChI:InChI=1/C17H25N5O12/c18-7(1-6(24)4-33-16(19)31)13(28)20-8(15(29)30)11-9(25)10(26)14(34-11)22-2-5(3-23)12(27)21-17(22)32/h2,6-11,14,23-26H,1,3-4,18H2,(H2,19,31)(H,20,28)(H,29,30)(H,21,27,32)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Polyoxin G

    CAS:
    <p>Polyoxin G is a nucleoside antifungal antibiotic noted for its significant efficacy against rice sheath blight.</p>
    Formula:C17H25N5O12
    Color and Shape:Solid
    Molecular weight:491.41