CymitQuimica logo

CAS 22976-89-2

:

2-[(2-amino-5-carbamoyloxy-3,4-dihydroxy-pentanoyl)amino]-2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxo-pyrimidin-1-yl)tetrahydrofuran-2-yl]acetic acid

Description:
The chemical substance with the name "2-[(2-amino-5-carbamoyloxy-3,4-dihydroxy-pentanoyl)amino]-2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxo-pyrimidin-1-yl)tetrahydrofuran-2-yl]acetic acid" and CAS number 22976-89-2 is a complex organic compound characterized by its intricate structure, which includes multiple functional groups such as amino, hydroxyl, and carboxylic acid moieties. This compound is likely to exhibit significant biological activity due to its structural features, which may facilitate interactions with biological macromolecules. Its stereochemistry, indicated by the specific configuration at several chiral centers, suggests that it may have specific pharmacological properties. The presence of both pyrimidine and tetrahydrofuran rings contributes to its potential as a bioactive molecule, possibly in the context of medicinal chemistry or biochemistry. Additionally, the compound's solubility, stability, and reactivity would be influenced by its functional groups and overall molecular architecture, making it a subject of interest for further research in drug development or biochemical applications.
Formula:C17H25N5O12
InChI:InChI=1/C17H25N5O12/c1-4-2-22(17(32)21-12(4)27)14-10(26)9(25)11(34-14)7(15(29)30)20-13(28)6(18)8(24)5(23)3-33-16(19)31/h2,5-11,14,23-26H,3,18H2,1H3,(H2,19,31)(H,20,28)(H,29,30)(H,21,27,32)/t5?,6?,7?,8?,9-,10+,11+,14+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.