CAS 22978-55-8

2-Chloro-N-(4-hydroxyphenyl)-5-nitrobenzamide

Description:

2-Chloro-N-(4-hydroxyphenyl)-5-nitrobenzamide, with the CAS number 22978-55-8, is an organic compound characterized by its complex structure, which includes a chloro group, a nitro group, and a hydroxyl group attached to a benzamide framework. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals and chemical research due to its functional groups that can participate in various chemical reactions. The presence of the nitro group suggests it may have electron-withdrawing properties, influencing its reactivity and interactions with biological systems. The hydroxyl group can contribute to hydrogen bonding, enhancing solubility in polar solvents. Additionally, the chloro substituent may affect the compound's lipophilicity and overall stability. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards. Its specific applications and behavior in biological systems would depend on further studies and context within medicinal chemistry.

Formula: C₁₃H₉ClN₂O₄

InChI: InChI=1S/C13H9ClN2O4/c14-12-6-3-9(16(19)20)7-11(12)13(18)15-8-1-4-10(17)5-2-8/h1-7,17H,(H,15,18)

InChI key: InChIKey=CGKVYRMRNZJQNG-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(O)C=C1)(=O)C2=CC(N(=O)=O)=CC=C2Cl

Synonyms:

• Benzanilide, 2-chloro-4′-hydroxy-5-nitro-
• benzamide, 2-chloro-N-(4-hydroxyphenyl)-5-nitro-
• 2-Chloro-N-(4-hydroxyphenyl)-5-nitrobenzamide

2-Chloro-N-(4-hydroxyphenyl)-5-nitrobenzamide

CAS: 22978-55-8

Formula: C₁₃H₉ClN₂O₄

Molecular weight: 292.6746

Ref: IN-DA002LR9

2-Chloro-N-(4-hydroxyphenyl)-5-nitrobenzamide

CAS: 22978-55-8

Versatile small molecule scaffold

Formula: C₁₃H₉ClN₂O₄

Purity: Min. 95%

Molecular weight: 292.67 g/mol

Ref: 3D-XAA97855