CymitQuimica logo

CAS 22982-86-1

:

N-[(1-Acetyl-1,2,3,4-tetrahydro-6-methyl-2-quinolinyl)methyl]-N-(1-methylethyl)acetamide

Description:
N-[(1-Acetyl-1,2,3,4-tetrahydro-6-methyl-2-quinolinyl)methyl]-N-(1-methylethyl)acetamide, with CAS number 22982-86-1, is a chemical compound characterized by its complex structure, which includes a quinoline moiety and acetamide functional groups. This compound typically exhibits properties associated with both organic amides and heterocyclic compounds, such as moderate solubility in organic solvents and potential biological activity. The presence of the tetrahydroquinoline structure suggests that it may interact with biological systems, possibly exhibiting pharmacological effects. Its molecular structure indicates that it may participate in hydrogen bonding due to the amide group, influencing its reactivity and interactions with other molecules. Additionally, the presence of acetyl and isopropyl groups may affect its lipophilicity and overall stability. As with many compounds of this nature, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on further empirical studies.
Formula:C18H26N2O2
InChI:InChI=1S/C18H26N2O2/c1-12(2)19(14(4)21)11-17-8-7-16-10-13(3)6-9-18(16)20(17)15(5)22/h6,9-10,12,17H,7-8,11H2,1-5H3
InChI key:InChIKey=VBLMGOZZZOXCTC-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C=2C(CCC1CN(C(C)C)C(C)=O)=CC(C)=CC2
Synonyms:
  • N-[(1-Acetyl-1,2,3,4-tetrahydro-6-methyl-2-quinolinyl)methyl]-N-(1-methylethyl)acetamide
  • Acetamide, N-[(1-acetyl-1,2,3,4-tetrahydro-6-methyl-2-quinolyl)methyl]-N-isopropyl-
  • Acetamide, N-[(1-acetyl-1,2,3,4-tetrahydro-6-methyl-2-quinolinyl)methyl]-N-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.