CAS 22985-02-0
:3,5-dimethylnaphtho[2,3-b]furan-4,9-dione
Description:
3,5-Dimethylnaphtho[2,3-b]furan-4,9-dione, with the CAS number 22985-02-0, is an organic compound characterized by its complex polycyclic structure, which includes a naphthalene core fused with a furan ring and two ketone functional groups. This compound typically exhibits a deep color, often appearing as a solid or crystalline material. It is known for its potential applications in organic synthesis and materials science, particularly in the development of dyes and pigments due to its conjugated system, which allows for strong light absorption. The presence of methyl groups at the 3 and 5 positions contributes to its stability and influences its reactivity. Additionally, the compound may exhibit interesting electronic properties, making it a subject of study in the field of organic electronics. Its solubility can vary depending on the solvent, and it may show varying degrees of stability under different environmental conditions. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C14H10O3
InChI:InChI=1/C14H10O3/c1-7-4-3-5-9-10(7)13(16)11-8(2)6-17-14(11)12(9)15/h3-6H,1-2H3
SMILES:Cc1cccc2c1C(=O)c1c(C)coc1C2=O
Synonyms:- 3,5-Dimethyl-naphtho(2,3-b)furan-4,9-dione
- Naphtho(2,3-b)furan-4,9-dione, 3,5-dimethyl-
- Maturinone
- 3,5-Dimethylnaphtho[2,3-b]furan-4,9-dione
- 3,5-dimethylbenzo[f][1]benzofuran-4,9-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
