CAS 22987-10-6
:N-(3-Aminophenyl)propanamide
Description:
N-(3-Aminophenyl)propanamide, also known by its CAS number 22987-10-6, is an organic compound characterized by the presence of an amide functional group attached to a propanamide chain and a 3-aminophenyl group. This compound features a benzene ring with an amino group (-NH2) positioned at the meta position relative to the amide linkage, which influences its chemical reactivity and properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine and amide groups, which can engage in hydrogen bonding. The compound may display biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. As with many amides, it may also participate in various chemical reactions, including hydrolysis and acylation, under appropriate conditions. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c1-2-9(12)11-8-5-3-4-7(10)6-8/h3-6H,2,10H2,1H3,(H,11,12)
InChI key:InChIKey=VGDKCRMZIWPMPW-UHFFFAOYSA-N
SMILES:N(C(CC)=O)C1=CC(N)=CC=C1
Synonyms:- 3′-Aminopropionanilide
- N-(3-aminophenyl)propanamide
- Propanamide, N-(3-aminophenyl)-
- m-Amino Propionanilide
- m-Aminopropionanilide
- N-(3-Aminophenyl)propionamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Propanamide, N-(3-aminophenyl)-
CAS:Formula:C9H12N2OPurity:98%Color and Shape:SolidMolecular weight:164.20443'-Aminopropionanilide
CAS:3'-Aminopropionanilide is a synthetic chemical that belongs to the group of aminopropionates. It has been used as a reaction component and reagent in organic synthesis. 3'-Aminopropionanilide is a versatile building block, which can be used to synthesize complex compounds with different functions. This compound is also an intermediate in the synthesis of other chemicals, such as pharmaceuticals or agrochemicals. 3'-Aminopropionanilide has a CAS number of 22987-10-6.Formula:C9H12N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:164.2 g/molN-(3-Aminophenyl)propionamide
CAS:Formula:C9H12N2OPurity:98%Color and Shape:SolidMolecular weight:164.208



