CAS 22996-19-6

4-Bromo-2-nitrobenzyl alcohol

Description:

4-Bromo-2-nitrobenzyl alcohol is an organic compound characterized by the presence of a bromine atom and a nitro group attached to a benzyl alcohol structure. Its molecular formula is C7H6BrN O3, indicating the presence of carbon, hydrogen, bromine, nitrogen, and oxygen atoms. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The bromine and nitro substituents contribute to its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the hydroxyl group (-OH) in the benzyl alcohol moiety can participate in hydrogen bonding, influencing its solubility and reactivity in different solvents. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation or toxicity. Proper storage and disposal methods are essential to ensure safety in laboratory settings.

Formula: C₇H₆BrNO₃

InChI: InChI=1/C7H6BrNO3/c8-6-2-1-5(4-10)7(3-6)9(11)12/h1-3,10H,4H2

SMILES: c1cc(cc(c1CO)N(=O)=O)Br

Benzenemethanol,4-bromo-2-nitro-

CAS: 22996-19-6

Formula: C₇H₆BrNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 232.0314

Ref: IN-DA00I4IF

4-Bromo-2-nitrobenzyl alcohol

CAS: 22996-19-6

4-Bromo-2-nitrobenzyl alcohol

Purity: 95%

Molecular weight: 232.03g/mol

Ref: 54-OR400605

4-Bromo-2-nitrobenzylalcohol

CAS: 22996-19-6

Formula: C₇H₆BrNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 232.033

Ref: 10-F093008