CAS 229970-69-8
:Carbamic acid, [4-[[(4-fluorophenyl)methyl]amino]-2-(β-D-glucopyranosylamino)phenyl]-, ethyl ester
Description:
Carbamic acid, with the specific structure described, is a complex organic compound characterized by the presence of a carbamate functional group, which is derived from carbamic acid itself. This compound features a phenyl ring substituted with a fluorine atom, indicating potential for unique electronic properties and reactivity. The presence of an ethyl ester group suggests that it may exhibit moderate lipophilicity, which can influence its solubility and bioavailability. Additionally, the incorporation of a β-D-glucopyranosylamino moiety indicates that the compound may have biological significance, potentially interacting with biological systems or serving as a prodrug. The overall structure suggests that it may possess both hydrophilic and hydrophobic characteristics, which could affect its pharmacokinetics and pharmacodynamics. As with many carbamate derivatives, it may exhibit biological activity, possibly as an enzyme inhibitor or in other therapeutic roles. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C22H28FN3O7
InChI:InChI=1S/C22H28FN3O7/c1-2-32-22(31)26-15-8-7-14(24-10-12-3-5-13(23)6-4-12)9-16(15)25-21-20(30)19(29)18(28)17(11-27)33-21/h3-9,17-21,24-25,27-30H,2,10-11H2,1H3,(H,26,31)/t17-,18-,19+,20-,21-/m1/s1
InChI key:InChIKey=QJZGGFBXRVPPEE-YMQHIKHWSA-N
SMILES:N(C1=C(NC(OCC)=O)C=CC(NCC2=CC=C(F)C=C2)=C1)[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O
Synonyms:- Carbamic acid, [4-[[(4-fluorophenyl)methyl]amino]-2-(β-D-glucopyranosylamino)phenyl]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Retigabine N-β-D-Glucoside
CAS:Controlled ProductFormula:C22H28FN3O7Color and Shape:NeatMolecular weight:465.472
