CymitQuimica logo

CAS 229970-95-0

:

N-Methoxy-N,2,3-trimethylbenzamide

Description:
N-Methoxy-N,2,3-trimethylbenzamide is an organic compound characterized by its amide functional group, which is derived from benzoic acid. This compound features a methoxy group (-OCH3) attached to the nitrogen atom of the amide, along with three methyl groups on the aromatic ring, specifically at the 2, 3, and 4 positions. The presence of these substituents contributes to its unique chemical properties, including its solubility in organic solvents and potential reactivity in various chemical reactions. The methoxy group can influence the compound's polarity and hydrogen bonding capabilities, while the trimethyl substitution on the benzene ring can affect its steric hindrance and electronic properties. N-Methoxy-N,2,3-trimethylbenzamide may be utilized in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and can vary based on purity and environmental conditions.
Formula:C11H15NO2
InChI:InChI=1S/C11H15NO2/c1-8-6-5-7-10(9(8)2)11(13)12(3)14-4/h5-7H,1-4H3
InChI key:InChIKey=VYNMPEHORBCFIS-UHFFFAOYSA-N
SMILES:C(N(OC)C)(=O)C1=C(C)C(C)=CC=C1
Synonyms:
  • Benzamide, N-methoxy-N,2,3-trimethyl-
  • N-Methoxy-N,2,3-trimethylbenzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.