CAS 229977-93-9

Fluacrypyrim

Description:

Fluacrypyrim, with the CAS number 229977-93-9, is a chemical compound primarily used as a fungicide in agricultural applications. It belongs to the class of pyrimidine derivatives and is known for its effectiveness against a variety of fungal pathogens. The compound exhibits a unique mode of action that disrupts the synthesis of essential cellular components in fungi, thereby inhibiting their growth and reproduction. Fluacrypyrim is typically characterized by its low toxicity to non-target organisms, making it a more environmentally friendly option compared to some traditional fungicides. It is often formulated in various forms, such as emulsifiable concentrates or granules, to enhance its application in crop protection. Additionally, its stability under various environmental conditions contributes to its efficacy in agricultural settings. As with any chemical substance, proper handling and adherence to safety guidelines are essential to minimize risks associated with its use.

Formula:C₂₀H₂₁F₃N₂O₅

InChI:InChI=1S/C20H21F3N2O5/c1-12(2)30-19-24-16(20(21,22)23)9-17(25-19)29-10-13-7-5-6-8-14(13)15(11-27-3)18(26)28-4/h5-9,11-12H,10H2,1-4H3/b15-11+

InChI key:InChIKey=MXWAGQASUDSFBG-RVDMUPIBSA-N

SMILES:C(\C(OC)=O)(=C/OC)/C1=C(COC=2C=C(C(F)(F)F)N=C(OC(C)C)N2)C=CC=C1

Synonyms:

Benzeneacetic acid, α-(methoxymethylene)-2-[[[2-(1-methylethoxy)-6-(trifluoromethyl)-4-pyrimidinyl]oxy]methyl]-, methyl ester, (αE)-
Methyl (E)-2-[2-[2-isopropoxy-6-(trifluoromethyl)pyrimidin-4-yloxymethyl]phenyl]-3-methoxyacrylate
Methyl (E)-2-[2-[[(2-isopropoxy-6-trifluoromethylpyrimidin-4-yl)oxy]methyl]phenyl]-3-methoxy-2-propenoate
benzeneacetic acid, alpha-(methoxymethylene)-2-[[[2-(1-methylethoxy)-6-(trifluoromethyl)-4-pyrimidinyl]oxy]methyl]-, methyl ester, (alphaE)-