CAS 2300-11-0
:(5beta,8alpha,9beta,10alpha,13alpha)-kaur-16-en-18-ol
Description:
The chemical substance known as (5beta,8alpha,9beta,10alpha,13alpha)-kaur-16-en-18-ol, with the CAS number 2300-11-0, is a naturally occurring compound classified as a terpenoid, specifically a kaurene derivative. It is characterized by its complex bicyclic structure, which includes multiple chiral centers, contributing to its stereochemistry. This compound is primarily found in various plant species, particularly in the family Asteraceae, and is known for its role in plant growth and development. Kaur-16-en-18-ol exhibits biological activities, including potential anti-inflammatory and anti-cancer properties, making it of interest in pharmacological research. Its hydrophobic nature and structural features allow it to interact with biological membranes, influencing its bioactivity. Additionally, this compound may serve as a precursor in the biosynthesis of other important phytochemicals. Overall, (5beta,8alpha,9beta,10alpha,13alpha)-kaur-16-en-18-ol represents a significant area of study within natural product chemistry and its applications in medicine and agriculture.
Formula:C20H32O
InChI:InChI=1S/C20H32O/c1-14-11-20-10-7-16-18(2,13-21)8-4-9-19(16,3)17(20)6-5-15(14)12-20/h15-17,21H,1,4-13H2,2-3H3/t15-,16-,17+,18+,19-,20-/m1/s1
InChI key:InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N
SMILES:C[C@]12[C@]3([C@]4(C[C@@](CC3)(C(=C)C4)[H])CC[C@@]1([C@@](CO)(C)CCC2)[H])[H]
Synonyms:- Kaurenol
- (-)-Kauren-19-ol
- (-)-Kaur-16-en-18-ol
- Kaur-16-en-18-ol, (4α)-
- (4α)-Kaur-16-en-18-ol
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
